(R)-(4-Benzylpiperazin-2-yl)methanol dihydrochloride, 98%
cas: 2306249-22-7 — see every product listed under this CAS number, including other names
(R)-(4-Benzylpiperazin-2-yl)methanol dihydrochloride, 98% (CAS 2306249-22-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1368388-250mg |
| cas | 2306249-22-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 553.94 Pln | |
| BLDpharm | 100mg | 131.09 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 519.84 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 976.40 Pln | |
| Fluorochem | 100mg | 117.68 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 560.24 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
[(2R)-4-benzylpiperazin-2-yl]methanol;dihydrochloride (CAS 2306249-22-7) is a chemical compound with the molecular formula C12H20Cl2N2O and a molecular weight of 279.20 g/mol. IUPAC name: [(2R)-4-benzylpiperazin-2-yl]methanol;dihydrochloride. InChIKey: WSABKJNYYBAXPM-CURYUGHLSA-N.
| Molecular formula | C12H20Cl2N2O |
|---|---|
| Molecular weight | 279.20 g/mol |
| IUPAC name | [(2R)-4-benzylpiperazin-2-yl]methanol;dihydrochloride |
| InChIKey | WSABKJNYYBAXPM-CURYUGHLSA-N |
| SMILES | C1CN(C[C@@H](N1)CO)CC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-(4-Benzylpiperazin-2-yl)methanol dihydrochloride, [(2R)-4-benzylpiperazin-2-yl]methanol;dihydrochloride, (R)-(4-Benzylpiperazin-2-yl)methanoldihydrochloride, [(2R)-4-benzylpiperazin-2-yl]methanol dihydrochloride, (R)-(4-Benzyl-2-piperazinyl)methanol Dihydrochloride, (R)-4-benzyl-2-hydroxymethylpiperazine dihydrochloride