CAS 1860012-50-5 appears in our catalog under these names: (S)-4-Benzyl-2-hydroxymethylpiperazine dihydrochloride, 95%, (S)-(4-Benzylpiperazin-2-yl)methanol dihydrochloride, 97%, (S)-4-Benzyl-2-hydroxymethylpiperazine 2hcl, 96%, 96%, [(2S)-4-benzylpiperazin-2-yl]methanol dihydrochloride, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 500mg.
[(2S)-4-benzylpiperazin-2-yl]methanol;dihydrochloride (CAS 1860012-50-5) is a chemical compound with the molecular formula C12H20Cl2N2O and a molecular weight of 279.20 g/mol. IUPAC name: [(2S)-4-benzylpiperazin-2-yl]methanol;dihydrochloride. InChIKey: WSABKJNYYBAXPM-LTCKWSDVSA-N.
| Molecular formula | C12H20Cl2N2O |
|---|---|
| Molecular weight | 279.20 g/mol |
| IUPAC name | [(2S)-4-benzylpiperazin-2-yl]methanol;dihydrochloride |
| InChIKey | WSABKJNYYBAXPM-LTCKWSDVSA-N |
| SMILES | C1CN(C[C@H](N1)CO)CC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)