CAS 129783-80-8 is the registry number for (S)-[1,1'-Binaphthalene]-2,2'-dicarbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-cyanonaphthalen-1-yl)naphthalene-2-carbonitrile (CAS 129783-80-8) is a chemical compound with the molecular formula C22H12N2 and a molecular weight of 304.3 g/mol. IUPAC name: 1-(2-cyanonaphthalen-1-yl)naphthalene-2-carbonitrile. InChIKey: PMGUUJLDTNSROF-UHFFFAOYSA-N.
| Molecular formula | C22H12N2 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 1-(2-cyanonaphthalen-1-yl)naphthalene-2-carbonitrile |
| InChIKey | PMGUUJLDTNSROF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)C#N)C#N |
Computed by PubChem (NCBI)