CAS 115584-22-0 appears in our catalog under these names: [1,1'-Binaphthalene]-4,4'-dicarbonitrile, 95%, 95%, [1,1'-Binaphthalene]-4,4'-dicarbonitrile, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(4-cyanonaphthalen-1-yl)naphthalene-1-carbonitrile (CAS 115584-22-0) is a chemical compound with the molecular formula C22H12N2 and a molecular weight of 304.3 g/mol. IUPAC name: 4-(4-cyanonaphthalen-1-yl)naphthalene-1-carbonitrile. InChIKey: BTMURUWJOOMXOG-UHFFFAOYSA-N.
| Molecular formula | C22H12N2 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 4-(4-cyanonaphthalen-1-yl)naphthalene-1-carbonitrile |
| InChIKey | BTMURUWJOOMXOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C3=CC=C(C4=CC=CC=C43)C#N)C#N |
Computed by PubChem (NCBI)