cas: 1204344-00-2 — see every product listed under this CAS number, including other names
(R)-1,1,1-Trifluoro-3-((4-methoxybenzyl)oxy)propan-2-ol 98% (CAS 1204344-00-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A800038-100mg |
| cas | 1204344-00-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 1054.56 Pln | |
| Ambeed | 10g | 2000.19 Pln | |
| Ambeed | 25g | 3935.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A800038 |
(2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-ol (CAS 1204344-00-2) is a chemical compound with the molecular formula C11H13F3O3 and a molecular weight of 250.21 g/mol. IUPAC name: (2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-ol. InChIKey: YDZVCRBHIKWKAU-SNVBAGLBSA-N.
| Molecular formula | C11H13F3O3 |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | (2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-ol |
| InChIKey | YDZVCRBHIKWKAU-SNVBAGLBSA-N |
| SMILES | COC1=CC=C(C=C1)COC[C@H](C(F)(F)F)O |
Computed by PubChem (NCBI)