cas: 1204344-00-2 — see every product listed under this CAS number, including other names
(R)-1,1,1-Trifluoro-3-[(4-methoxybenzyl)oxy]-2-propanol, 98%, 98% (CAS 1204344-00-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12F39P-100mg |
| cas | 1204344-00-2 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 818.00 Pln | |
| Chemat | 10g | 1542.80 Pln | |
| Chemat | 25g | 3026.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-ol (CAS 1204344-00-2) is a chemical compound with the molecular formula C11H13F3O3 and a molecular weight of 250.21 g/mol. IUPAC name: (2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-ol. InChIKey: YDZVCRBHIKWKAU-SNVBAGLBSA-N.
| Molecular formula | C11H13F3O3 |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | (2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-ol |
| InChIKey | YDZVCRBHIKWKAU-SNVBAGLBSA-N |
| SMILES | COC1=CC=C(C=C1)COC[C@H](C(F)(F)F)O |
Computed by PubChem (NCBI)