cas: 1159598-21-6 — see every product listed under this CAS number, including other names
(R)-1,4-(DI-BOC)-2-(HYDROXYMETHYL)PIPERAZINE, 98%, 98% (CAS 1159598-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HD5X-100mg |
| cas | 1159598-21-6 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 515.60 Pln | |
| Chemat | 5g | 1648.40 Pln | |
| Chemat | 10g | 2920.40 Pln | |
| Chemat | 25g | 5776.40 Pln | |
| Chemat | 100g | 18352.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl (2R)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate (CAS 1159598-21-6) is a chemical compound with the molecular formula C15H28N2O5 and a molecular weight of 316.39 g/mol. IUPAC name: ditert-butyl (2R)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate. InChIKey: TXCFQKQBPSGAKK-LLVKDONJSA-N.
| Molecular formula | C15H28N2O5 |
|---|---|
| Molecular weight | 316.39 g/mol |
| IUPAC name | ditert-butyl (2R)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate |
| InChIKey | TXCFQKQBPSGAKK-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H](C1)CO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)