cas: 748810-28-8 — see every product listed under this CAS number, including other names
(R)-1-((1R,2R)-2-(3,4-Dimethoxyphenethoxy)cyclohexyl)pyrrolidin-3-ol hydrochloride, 99%, 99% (CAS 748810-28-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G4QF-1mg |
| cas | 748810-28-8 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 117.20 Pln | |
| Chemat | 2mg | 131.60 Pln | |
| Chemat | 10mg | 203.60 Pln | |
| Chemat | 25mg | 342.80 Pln | |
| Chemat | 50mg | 539.60 Pln | |
| Chemat | 100mg | 870.80 Pln | |
| Chemat | 250mg | 1437.20 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(3R)-1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol;hydrochloride (CAS 748810-28-8) is a chemical compound with the molecular formula C20H32ClNO4 and a molecular weight of 385.9 g/mol. IUPAC name: (3R)-1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol;hydrochloride. InChIKey: JMHYCBFEEFHTMK-IIUXMCBISA-N.
| Molecular formula | C20H32ClNO4 |
|---|---|
| Molecular weight | 385.9 g/mol |
| IUPAC name | (3R)-1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol;hydrochloride |
| InChIKey | JMHYCBFEEFHTMK-IIUXMCBISA-N |
| SMILES | COC1=C(C=C(C=C1)CCO[C@@H]2CCCC[C@H]2N3CC[C@H](C3)O)OC.Cl |
Computed by PubChem (NCBI)