CAS 795282-00-7 appears in our catalog under these names: Vernakalant Impurity 1, Vernakalant Impurity 1 ((3S,1'S,2'S)-Isomer) HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-1-[(1S,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol;hydrochloride (CAS 795282-00-7) is a chemical compound with the molecular formula C20H32ClNO4 and a molecular weight of 385.9 g/mol. IUPAC name: (3S)-1-[(1S,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol;hydrochloride. InChIKey: JMHYCBFEEFHTMK-UVJOBNTFSA-N.
| Molecular formula | C20H32ClNO4 |
|---|---|
| Molecular weight | 385.9 g/mol |
| IUPAC name | (3S)-1-[(1S,2S)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol;hydrochloride |
| InChIKey | JMHYCBFEEFHTMK-UVJOBNTFSA-N |
| SMILES | COC1=C(C=C(C=C1)CCO[C@H]2CCCC[C@@H]2N3CC[C@@H](C3)O)OC.Cl |
Computed by PubChem (NCBI)