cas: 1629681-80-6 — see every product listed under this CAS number, including other names
(R)-1-(2,4-Dimethoxybenzyl)-5-oxopyrrolidine-3-carboxylic acid, 97%, 97% (CAS 1629681-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TK7-100mg |
| cas | 1629681-80-6 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 500mg | 616.40 Pln | |
| Chemat | 1g | 894.80 Pln | |
| Chemat | 5g | 2517.20 Pln | |
| Chemat | 10g | 4182.80 Pln | |
| Chemat | 25g | 6107.60 Pln | |
| Chemat | 100g | 15846.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 1629681-80-6) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: (3R)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: OZFGRQLUQFPWPR-SNVBAGLBSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (3R)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | OZFGRQLUQFPWPR-SNVBAGLBSA-N |
| SMILES | COC1=CC(=C(C=C1)CN2C[C@@H](CC2=O)C(=O)O)OC |
Computed by PubChem (NCBI)