cas: 771465-40-8 — see every product listed under this CAS number, including other names
(R)-1-(3,5-Difluorophenyl)ethanamine 95% (CAS 771465-40-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174540-100mg |
| cas | 771465-40-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1087.94 Pln | |
| Ambeed | 5g | 3657.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A174540 |
(1R)-1-(3,5-difluorophenyl)ethanamine (CAS 771465-40-8) is a chemical compound with the molecular formula C8H9F2N and a molecular weight of 157.16 g/mol. IUPAC name: (1R)-1-(3,5-difluorophenyl)ethanamine. InChIKey: XTIXPIMMHGCRJD-RXMQYKEDSA-N.
| Molecular formula | C8H9F2N |
|---|---|
| Molecular weight | 157.16 g/mol |
| IUPAC name | (1R)-1-(3,5-difluorophenyl)ethanamine |
| InChIKey | XTIXPIMMHGCRJD-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)F)F)N |
Computed by PubChem (NCBI)