CAS 444643-16-7 appears in our catalog under these names: (S)-1-(3,5-Difluorophenyl)ethanamine, 98%, (S)–1–(3,5–Difluorophenyl)ethanamine. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
(1S)-1-(3,5-difluorophenyl)ethanamine (CAS 444643-16-7) is a chemical compound with the molecular formula C8H9F2N and a molecular weight of 157.16 g/mol. IUPAC name: (1S)-1-(3,5-difluorophenyl)ethanamine. InChIKey: XTIXPIMMHGCRJD-YFKPBYRVSA-N.
| Molecular formula | C8H9F2N |
|---|---|
| Molecular weight | 157.16 g/mol |
| IUPAC name | (1S)-1-(3,5-difluorophenyl)ethanamine |
| InChIKey | XTIXPIMMHGCRJD-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=CC(=CC(=C1)F)F)N |
Computed by PubChem (NCBI)