cas: 842169-97-5 — see every product listed under this CAS number, including other names
(R)-1-(3-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride, 95%, 95% (CAS 842169-97-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G96X-100mg |
| cas | 842169-97-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1970.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 842169-97-5) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: (1R)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: DRGOYEFQAGQGHF-OGFXRTJISA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | (1R)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | DRGOYEFQAGQGHF-OGFXRTJISA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)