CAS 1214331-01-7 appears in our catalog under these names: 2-Bromo-5-(trifluoromethyl)benzylamine hydrochloride, 95%, 2-Bromo-5-(trifluoromethyl)benzylamine hydrochloride, 2-Bromo-5-(trifluoromethyl)benzylamine h, ydrochloride, 5 g, 2-Bromo-5-(trifluoromethyl)benzylamine h, ydrochloride, 10 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 10g, 1g, 25g, 5g.
[2-bromo-5-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 1214331-01-7) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: [2-bromo-5-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: PUYKBKYDRAEWIQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | [2-bromo-5-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | PUYKBKYDRAEWIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CN)Br.Cl |
Computed by PubChem (NCBI)