cas: 1167414-90-5 — see every product listed under this CAS number, including other names
(R)-1-(3-Chlorophenyl)ethanamine hydrochloride, 98% (CAS 1167414-90-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F327776-1G |
| cas | 1167414-90-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 2.5g | 529.00 Pln | |
| Fluorochem | 5g | 1002.79 Pln | |
| Fluorochem | 10g | 1950.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-(3-chlorophenyl)ethanamine;hydrochloride (CAS 1167414-90-5) is a chemical compound with the molecular formula C8H11Cl2N and a molecular weight of 192.08 g/mol. IUPAC name: (1R)-1-(3-chlorophenyl)ethanamine;hydrochloride. InChIKey: UZDXSKJUCKLUON-FYZOBXCZSA-N.
| Molecular formula | C8H11Cl2N |
|---|---|
| Molecular weight | 192.08 g/mol |
| IUPAC name | (1R)-1-(3-chlorophenyl)ethanamine;hydrochloride |
| InChIKey | UZDXSKJUCKLUON-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)Cl)N.Cl |
Computed by PubChem (NCBI)