CAS 1167414-90-5 appears in our catalog under these names: (R)-1-(3-Chlorophenyl)ethanamine hydrochloride, 95%, (R)-1-(3-Chlorophenyl)ethanamine HCl, (R)-1-(3-Chlorophenyl)ethanamine hydrochloride, 98%, 98%, (R)-1-(3-Chlorophenyl)ethanamine hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 10g, 2.5g.
(1R)-1-(3-chlorophenyl)ethanamine;hydrochloride (CAS 1167414-90-5) is a chemical compound with the molecular formula C8H11Cl2N and a molecular weight of 192.08 g/mol. IUPAC name: (1R)-1-(3-chlorophenyl)ethanamine;hydrochloride. InChIKey: UZDXSKJUCKLUON-FYZOBXCZSA-N.
| Molecular formula | C8H11Cl2N |
|---|---|
| Molecular weight | 192.08 g/mol |
| IUPAC name | (1R)-1-(3-chlorophenyl)ethanamine;hydrochloride |
| InChIKey | UZDXSKJUCKLUON-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)Cl)N.Cl |
Computed by PubChem (NCBI)