cas: 115103-54-3 — see every product listed under this CAS number, including other names
(R)-1-(4,4-Bis(3-methylthiophen-2-yl)but-3-en-1-yl)piperidine-3-carboxylic acid, 99% (CAS 115103-54-3) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F903857-10MG |
| cas | 115103-54-3 |
| size | 10mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10mg | 539.41 Pln | |
| Fluorochem | 25mg | 950.72 Pln | |
| Fluorochem | 50mg | 1679.63 Pln | |
| Fluorochem | 100mg | 2793.83 Pln | |
| Chemat | 10mg | 328.40 Pln | |
| Chemat | 25mg | 573.20 Pln | |
| Chemat | 50mg | 1010.00 Pln | |
| Chemat | 100mg | 1667.60 Pln |
| purity | 99% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid (CAS 115103-54-3) is a chemical compound with the molecular formula C20H25NO2S2 and a molecular weight of 375.6 g/mol. IUPAC name: (3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid. InChIKey: PBJUNZJWGZTSKL-MRXNPFEDSA-N.
| Molecular formula | C20H25NO2S2 |
|---|---|
| Molecular weight | 375.6 g/mol |
| IUPAC name | (3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid |
| InChIKey | PBJUNZJWGZTSKL-MRXNPFEDSA-N |
| SMILES | CC1=C(SC=C1)C(=CCCN2CCC[C@H](C2)C(=O)O)C3=C(C=CS3)C |
Computed by PubChem (NCBI)