CAS 115103-54-3 appears in our catalog under these names: (R)-1-(4,4-Bis(3-methylthiophen-2-yl)but-3-en-1-yl)piperidine-3-carboxylic acid, 99%, Tiagabine, 98+%, Tiagabine, >95% (HPLC), Tiagabine/ 99.24% (existing batch purity), Tiagabine. Offered by: Fluorochem, AmBeed, TRC, TargetMol, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 5mg, 10mM (in 1ml dmso), 10 mg, 100 mg.
(3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid (CAS 115103-54-3) is a chemical compound with the molecular formula C20H25NO2S2 and a molecular weight of 375.6 g/mol. IUPAC name: (3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid. InChIKey: PBJUNZJWGZTSKL-MRXNPFEDSA-N.
| Molecular formula | C20H25NO2S2 |
|---|---|
| Molecular weight | 375.6 g/mol |
| IUPAC name | (3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid |
| InChIKey | PBJUNZJWGZTSKL-MRXNPFEDSA-N |
| SMILES | CC1=C(SC=C1)C(=CCCN2CCC[C@H](C2)C(=O)O)C3=C(C=CS3)C |
Computed by PubChem (NCBI)