cas: 1167414-87-0 — see every product listed under this CAS number, including other names
(R)-1-(4-Chlorophenyl)ethanamine hydrochloride, 97% (CAS 1167414-87-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210152-1G |
| cas | 1167414-87-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 5g | 388.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-(4-chlorophenyl)ethanamine;hydrochloride (CAS 1167414-87-0) is a chemical compound with the molecular formula C8H11Cl2N and a molecular weight of 192.08 g/mol. IUPAC name: (1R)-1-(4-chlorophenyl)ethanamine;hydrochloride. InChIKey: BADVPOKOZMYLPI-FYZOBXCZSA-N.
| Molecular formula | C8H11Cl2N |
|---|---|
| Molecular weight | 192.08 g/mol |
| IUPAC name | (1R)-1-(4-chlorophenyl)ethanamine;hydrochloride |
| InChIKey | BADVPOKOZMYLPI-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)