cas: 1257638-63-3 — see every product listed under this CAS number, including other names
(R)-1-(5-Bromopyridin-2-yl)ethanamine dihydrochloride 98% (CAS 1257638-63-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A538491-100mg |
| cas | 1257638-63-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 576.19 Pln | |
| Ambeed | 1g | 2094.75 Pln | |
| Ambeed | 5g | 5710.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A538491 |
(1R)-1-(5-bromo-2-pyridinyl)ethanamine;dihydrochloride (CAS 1257638-63-3) is a chemical compound with the molecular formula C7H11BrCl2N2 and a molecular weight of 273.98 g/mol. IUPAC name: (1R)-1-(5-bromo-2-pyridinyl)ethanamine;dihydrochloride. InChIKey: SOOAYJPBXRUXBZ-ZJIMSODOSA-N.
| Molecular formula | C7H11BrCl2N2 |
|---|---|
| Molecular weight | 273.98 g/mol |
| IUPAC name | (1R)-1-(5-bromo-2-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | SOOAYJPBXRUXBZ-ZJIMSODOSA-N |
| SMILES | C[C@H](C1=NC=C(C=C1)Br)N.Cl.Cl |
Computed by PubChem (NCBI)