cas: 1257638-63-3 — see every product listed under this CAS number, including other names
(R)-1-(5-Bromopyridin-2-yl)ethanamine dihydrochloride, 98%, 98% (CAS 1257638-63-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDW4-100mg |
| cas | 1257638-63-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 1g | 1461.20 Pln | |
| Chemat | 5g | 4643.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-(5-bromo-2-pyridinyl)ethanamine;dihydrochloride (CAS 1257638-63-3) is a chemical compound with the molecular formula C7H11BrCl2N2 and a molecular weight of 273.98 g/mol. IUPAC name: (1R)-1-(5-bromo-2-pyridinyl)ethanamine;dihydrochloride. InChIKey: SOOAYJPBXRUXBZ-ZJIMSODOSA-N.
| Molecular formula | C7H11BrCl2N2 |
|---|---|
| Molecular weight | 273.98 g/mol |
| IUPAC name | (1R)-1-(5-bromo-2-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | SOOAYJPBXRUXBZ-ZJIMSODOSA-N |
| SMILES | C[C@H](C1=NC=C(C=C1)Br)N.Cl.Cl |
Computed by PubChem (NCBI)