CAS 1202070-39-0 appears in our catalog under these names: (R)-1-(5-Fluoropyridin-2-yl)ethanamine hydrochloride, 95%, (R)–1–(5–Fluoropyridin–2–yl)ethanamine hydrochloride, (R)-1-(5-Fluoropyridin-2-yl)ethanamine HCl, (R)-1-(5-Fluoropyridin-2-yl)ethanamine hydrochloride, 95%, 95%, (R)-1-(5-FLUOROPYRIDIN-2-YL)ETHANAMINE HCL, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 0,5g, 0,25g, 2g, 5g.
(1R)-1-(5-fluoro-2-pyridinyl)ethanamine;hydrochloride (CAS 1202070-39-0) is a chemical compound with the molecular formula C7H10ClFN2 and a molecular weight of 176.62 g/mol. IUPAC name: (1R)-1-(5-fluoro-2-pyridinyl)ethanamine;hydrochloride. InChIKey: XGSNHILBBHFTPS-NUBCRITNSA-N.
| Molecular formula | C7H10ClFN2 |
|---|---|
| Molecular weight | 176.62 g/mol |
| IUPAC name | (1R)-1-(5-fluoro-2-pyridinyl)ethanamine;hydrochloride |
| InChIKey | XGSNHILBBHFTPS-NUBCRITNSA-N |
| SMILES | C[C@H](C1=NC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)