CAS 1956437-56-1 appears in our catalog under these names: (S)–1–(6–Fluoropyridin–2–yl)ethanamine hydrochloride, (S)-1-(6-Fluoropyridin-2-yl)ethanamine hydrochloride, 95%, (S)-1-(6-Fluoropyridin-2-yl)ethanamine hydrochloride 97%. Offered by: GLPBio, Combi-blocks, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(6-fluoro-2-pyridinyl)ethanamine;hydrochloride (CAS 1956437-56-1) is a chemical compound with the molecular formula C7H10ClFN2 and a molecular weight of 176.62 g/mol. IUPAC name: (1S)-1-(6-fluoro-2-pyridinyl)ethanamine;hydrochloride. InChIKey: KRZXUDJJKFDGGT-JEDNCBNOSA-N.
| Molecular formula | C7H10ClFN2 |
|---|---|
| Molecular weight | 176.62 g/mol |
| IUPAC name | (1S)-1-(6-fluoro-2-pyridinyl)ethanamine;hydrochloride |
| InChIKey | KRZXUDJJKFDGGT-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=NC(=CC=C1)F)N.Cl |
Computed by PubChem (NCBI)