cas: 52193-85-8 — see every product listed under this CAS number, including other names
(R)-1-(Naphthalen-2-yl)ethanol 95% (CAS 52193-85-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A476681-100mg |
| cas | 52193-85-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 982.25 Pln | |
| Ambeed | 25g | 3707.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A476681 |
(1R)-1-naphthalen-2-ylethanol (CAS 52193-85-8) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: (1R)-1-naphthalen-2-ylethanol. InChIKey: AXRKCRWZRKETCK-SECBINFHSA-N.
| Molecular formula | C12H12O |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | (1R)-1-naphthalen-2-ylethanol |
| InChIKey | AXRKCRWZRKETCK-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC2=CC=CC=C2C=C1)O |
Computed by PubChem (NCBI)