cas: 52193-85-8 — see every product listed under this CAS number, including other names
(R)-1-(Naphthalen-2-yl)ethanol, 98%, 98% (CAS 52193-85-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C6S-100mg |
| cas | 52193-85-8 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 698.00 Pln | |
| Chemat | 25g | 1230.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-naphthalen-2-ylethanol (CAS 52193-85-8) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: (1R)-1-naphthalen-2-ylethanol. InChIKey: AXRKCRWZRKETCK-SECBINFHSA-N.
| Molecular formula | C12H12O |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | (1R)-1-naphthalen-2-ylethanol |
| InChIKey | AXRKCRWZRKETCK-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC2=CC=CC=C2C=C1)O |
Computed by PubChem (NCBI)