cas: 140645-23-4 — see every product listed under this CAS number, including other names
(R)-1-Boc-3-(Aminomethyl)piperidine 97% (CAS 140645-23-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A414192-250mg |
| cas | 140645-23-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1388.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A414192 |
Tert-butyl (3R)-3-(aminomethyl)piperidine-1-carboxylate (CAS 140645-23-4) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (3R)-3-(aminomethyl)piperidine-1-carboxylate. InChIKey: WPWXYQIMXTUMJB-SECBINFHSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (3R)-3-(aminomethyl)piperidine-1-carboxylate |
| InChIKey | WPWXYQIMXTUMJB-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)CN |
Computed by PubChem (NCBI)