cas: 39995-50-1 — see every product listed under this CAS number, including other names
(R)-2,2,2-Trifluoro-N-(1-phenylethyl)acetamide, 98%, 98% (CAS 39995-50-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7E6-100mg |
| cas | 39995-50-1 |
| size | 100mg |
| availability | 275g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2406.80 Pln | |
| Chemat | 25g | 4744.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide (CAS 39995-50-1) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: 2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide. InChIKey: ZJFCMJDNHPXGBY-SSDOTTSWSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide |
| InChIKey | ZJFCMJDNHPXGBY-SSDOTTSWSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)