CAS 881426-13-7 is the registry number for (S)-N-(1,1,1-Trifluoropropan-2-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
N-[(2S)-1,1,1-trifluoropropan-2-yl]benzamide (CAS 881426-13-7) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: N-[(2S)-1,1,1-trifluoropropan-2-yl]benzamide. InChIKey: AYNNRIXQAVTECA-ZETCQYMHSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | N-[(2S)-1,1,1-trifluoropropan-2-yl]benzamide |
| InChIKey | AYNNRIXQAVTECA-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(F)(F)F)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)