cas: 387824-79-5 — see every product listed under this CAS number, including other names
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(((benzyloxy)carbonyl)amino)butanoic acid (CAS 387824-79-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F763480-100MG |
| cas | 387824-79-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 664.37 Pln | |
| Fluorochem | 1g | 1622.36 Pln | |
| Fluorochem | 5g | 2809.45 Pln |
| delivery time | 3-4 weeks |
|---|
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(phenylmethoxycarbonylamino)butanoic acid (CAS 387824-79-5) is a chemical compound with the molecular formula C27H26N2O6 and a molecular weight of 474.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: VHBSCTCUNZLWCT-XMMPIXPASA-N.
| Molecular formula | C27H26N2O6 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | VHBSCTCUNZLWCT-XMMPIXPASA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)