Products 779335-06-7
CAS 779335-06-7 appears in our catalog under these names: Boc-3-amino-5-(fmoc-amino)-benzoic acid, 95%, Boc-3-amino-5-(Fmoc-amino)benzoic acid 98%, Boc-3-amino-5-(fmoc-amino)-benzoic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 779335-06-7) is a chemical compound with the molecular formula C27H26N2O6 and a molecular weight of 474.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: KNYZSHDTFJANSS-UHFFFAOYSA-N.
| Molecular formula | C27H26N2O6 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | KNYZSHDTFJANSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)