(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-(tert-butoxy)phenyl)butanoic acid, 98%
cas: 2446043-05-4 — see every product listed under this CAS number, including other names
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-(tert-butoxy)phenyl)butanoic acid, 98% (CAS 2446043-05-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD01535719-100mg |
| cas | 2446043-05-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 569.82 Pln | |
| BLDpharm | 250mg | 969.68 Pln | |
| BLDpharm | 1g | 2502.48 Pln | |
| BLDpharm | 5g | 8561.45 Pln | |
| Chemat | 50mg | 290.00 Pln | |
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 4888.40 Pln | |
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 919.49 Pln | |
| Fluorochem | 1g | 2382.51 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butanoic acid (CAS 2446043-05-4) is a chemical compound with the molecular formula C29H31NO5 and a molecular weight of 473.6 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butanoic acid. InChIKey: FKUBPXDMQFEPGP-AREMUKBSSA-N.
| Molecular formula | C29H31NO5 |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butanoic acid |
| InChIKey | FKUBPXDMQFEPGP-AREMUKBSSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)CC[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)