cas: 214750-74-0 — see every product listed under this CAS number, including other names
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-(((allyloxy)carbonyl)amino)pentanoic acid, 96%, 96% (CAS 214750-74-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C2KP-100mg |
| cas | 214750-74-0 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 549.20 Pln | |
| Chemat | 10g | 899.60 Pln | |
| Chemat | 25g | 1787.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(prop-2-enoxycarbonylamino)pentanoic acid (CAS 214750-74-0) is a chemical compound with the molecular formula C24H26N2O6 and a molecular weight of 438.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(prop-2-enoxycarbonylamino)pentanoic acid. InChIKey: RXLIOYNXBHZZBI-OAQYLSRUSA-N.
| Molecular formula | C24H26N2O6 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(prop-2-enoxycarbonylamino)pentanoic acid |
| InChIKey | RXLIOYNXBHZZBI-OAQYLSRUSA-N |
| SMILES | C=CCOC(=O)NCCC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)