cas: 214750-74-0 — see every product listed under this CAS number, including other names
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-(((allyloxy)carbonyl)amino)pentanoic acid, 96% (CAS 214750-74-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695136-1G |
| cas | 214750-74-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 857.01 Pln | |
| Fluorochem | 25g | 2783.41 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(prop-2-enoxycarbonylamino)pentanoic acid (CAS 214750-74-0) is a chemical compound with the molecular formula C24H26N2O6 and a molecular weight of 438.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(prop-2-enoxycarbonylamino)pentanoic acid. InChIKey: RXLIOYNXBHZZBI-OAQYLSRUSA-N.
| Molecular formula | C24H26N2O6 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(prop-2-enoxycarbonylamino)pentanoic acid |
| InChIKey | RXLIOYNXBHZZBI-OAQYLSRUSA-N |
| SMILES | C=CCOC(=O)NCCC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)