cas: 127474-54-8 — see every product listed under this CAS number, including other names
(R)-2-(((Benzyloxy)carbonyl)amino)pent-4-enoic acid, 97%, 97% (CAS 127474-54-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111X5C-100mg |
| cas | 127474-54-8 |
| size | 100mg |
| availability | 80g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 597.20 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 1614.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(phenylmethoxycarbonylamino)pent-4-enoic acid (CAS 127474-54-8) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)pent-4-enoic acid. InChIKey: DGEZDWGCGXHLEW-LLVKDONJSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)pent-4-enoic acid |
| InChIKey | DGEZDWGCGXHLEW-LLVKDONJSA-N |
| SMILES | C=CC[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)