CAS 78553-51-2 appears in our catalog under these names: (2S)-2-(((phenylmethoxy)carbonyl)amino)-4-Pentenoic acid, (S)–2–(((Benzyloxy)carbonyl)amino)pent–4–enoic acid, (2S)-2-(((Benzyloxy)carbonyl)amino)pent-4-enoic acid, 98%, 98%, (S)-2-(((Benzyloxy)carbonyl)amino)pent-4-enoic acid, 98.39%, (S)-2-(((Benzyloxy)carbonyl)amino)pent-4-enoic acid, 98%. Offered by: TRC, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1g, 500mg, 250mg, 5g, 25g, 5 g, 1 g.
(2S)-2-(phenylmethoxycarbonylamino)pent-4-enoic acid (CAS 78553-51-2) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: (2S)-2-(phenylmethoxycarbonylamino)pent-4-enoic acid. InChIKey: DGEZDWGCGXHLEW-NSHDSACASA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | (2S)-2-(phenylmethoxycarbonylamino)pent-4-enoic acid |
| InChIKey | DGEZDWGCGXHLEW-NSHDSACASA-N |
| SMILES | C=CC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)