cas: 147208-69-3 — see every product listed under this CAS number, including other names
(R)-2-((3aS,4S,6S,7aR)-3a,5,5-Trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborol-2-yl)pyrrolidine hydrochloride, 97%, 97% (CAS 147208-69-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112EPJ-100mg |
| cas | 147208-69-3 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 712.40 Pln | |
| Chemat | 1g | 2061.20 Pln | |
| Chemat | 5g | 6338.00 Pln | |
| Chemat | 10g | 10730.00 Pln | |
| Chemat | 500mg | 1312.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine;hydrochloride (CAS 147208-69-3) is a chemical compound with the molecular formula C14H25BClNO2 and a molecular weight of 285.62 g/mol. IUPAC name: (2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine;hydrochloride. InChIKey: OVVMNBVQOPZMPY-AKDYBRCWSA-N.
| Molecular formula | C14H25BClNO2 |
|---|---|
| Molecular weight | 285.62 g/mol |
| IUPAC name | (2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine;hydrochloride |
| InChIKey | OVVMNBVQOPZMPY-AKDYBRCWSA-N |
| SMILES | B1(O[C@@H]2C[C@@H]3C[C@H]([C@@]2(O1)C)C3(C)C)[C@@H]4CCCN4.Cl |
Computed by PubChem (NCBI)