cas: 147208-69-3 — see every product listed under this CAS number, including other names
Pyrrolidine, 2-[(3aS,4S,6S,7aR)-hexahydro-3a,5,5-trimethyl-4,6-methano-1,3,2-benzodioxaborol-2-yl]-, hydrochloride (1:1), (2R)-, 98% (CAS 147208-69-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F980078-100MG |
| cas | 147208-69-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 726.85 Pln | |
| Fluorochem | 250mg | 1065.27 Pln | |
| Fluorochem | 1g | 2575.15 Pln | |
| Fluorochem | 5g | 8901.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine;hydrochloride (CAS 147208-69-3) is a chemical compound with the molecular formula C14H25BClNO2 and a molecular weight of 285.62 g/mol. IUPAC name: (2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine;hydrochloride. InChIKey: OVVMNBVQOPZMPY-AKDYBRCWSA-N.
| Molecular formula | C14H25BClNO2 |
|---|---|
| Molecular weight | 285.62 g/mol |
| IUPAC name | (2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine;hydrochloride |
| InChIKey | OVVMNBVQOPZMPY-AKDYBRCWSA-N |
| SMILES | B1(O[C@@H]2C[C@@H]3C[C@H]([C@@]2(O1)C)C3(C)C)[C@@H]4CCCN4.Cl |
Computed by PubChem (NCBI)