(R)-2-(6-Cyclopropylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole, 95%
cas: 2828438-51-1 — see every product listed under this CAS number, including other names
(R)-2-(6-Cyclopropylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole, 95% (CAS 2828438-51-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1519817-250mg |
| cas | 2828438-51-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 787.56 Pln | |
| Ambeed | 1g | 2300.56 Pln | |
| Ambeed | 5g | 8997.81 Pln | |
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 2051.60 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 769.75 Pln | |
| BLDpharm | 1g | 2252.56 Pln | |
| BLDpharm | 5g | 8822.47 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4R)-2-(6-cyclopropyl-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole (CAS 2828438-51-1) is a chemical compound with the molecular formula C17H16N2O and a molecular weight of 264.32 g/mol. IUPAC name: (4R)-2-(6-cyclopropyl-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: GSHXRSCOEPAEKW-INIZCTEOSA-N.
| Molecular formula | C17H16N2O |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | (4R)-2-(6-cyclopropyl-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | GSHXRSCOEPAEKW-INIZCTEOSA-N |
| SMILES | C1CC1C2=NC(=CC=C2)C3=N[C@@H](CO3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-(6-Cyclopropylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole, (R)-2-(6-Cyclopropyl-2-pyridyl)-4-phenyl-4,5-dihydrooxazole, (4R)-2-(6-cyclopropyl-2-pyridyl)-4-phenyl-4,5-dihydrooxazole, (4R)-2-(6-cyclopropylpyridin-2-yl)-4-phenyl-4,5-dihydro-1,3-oxazole, Pyridine, 2-cyclopropyl-6-[(4R)-4,5-dihydro-4-phenyl-2-oxazolyl]-