CAS 1915-80-6 appears in our catalog under these names: Methylmethaqualone, Methylmethaqualone, 90.0%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5g, 1mg, 5mg, 1 mg, 5 mg.
3-(2,4-dimethylphenyl)-2-methylquinazolin-4-one (CAS 1915-80-6) is a chemical compound with the molecular formula C17H16N2O and a molecular weight of 264.32 g/mol. IUPAC name: 3-(2,4-dimethylphenyl)-2-methylquinazolin-4-one. InChIKey: MPMDMUROZIYIIM-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 3-(2,4-dimethylphenyl)-2-methylquinazolin-4-one |
| InChIKey | MPMDMUROZIYIIM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=NC3=CC=CC=C3C2=O)C)C |
Computed by PubChem (NCBI)