cas: 259537-92-3 — see every product listed under this CAS number, including other names
(R)-2-(Aminomethyl)-1-N-Boc-pyrrolidine, 95% (CAS 259537-92-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011384-100G |
| cas | 259537-92-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 2642.84 Pln | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 325.94 Pln | |
| Fluorochem | 25g | 732.05 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate (CAS 259537-92-3) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate. InChIKey: SOGXYCNKQQJEED-MRVPVSSYSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate |
| InChIKey | SOGXYCNKQQJEED-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CN |
Computed by PubChem (NCBI)