cas: 2501907-26-0 — see every product listed under this CAS number, including other names
(R)-2-Amino-2-(2-methoxyphenyl)ethanol hydrochloride 95% (CAS 2501907-26-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1258341-50mg |
| cas | 2501907-26-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 548.38 Pln | |
| Ambeed | 100mg | 648.50 Pln | |
| Ambeed | 250mg | 759.75 Pln | |
| Ambeed | 1g | 1911.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1258341 |
(2R)-2-amino-2-(2-methoxyphenyl)ethanol;hydrochloride (CAS 2501907-26-0) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: (2R)-2-amino-2-(2-methoxyphenyl)ethanol;hydrochloride. InChIKey: QOAVNXAFMBMWPP-QRPNPIFTSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-methoxyphenyl)ethanol;hydrochloride |
| InChIKey | QOAVNXAFMBMWPP-QRPNPIFTSA-N |
| SMILES | COC1=CC=CC=C1[C@H](CO)N.Cl |
Computed by PubChem (NCBI)