CAS 221697-17-2 appears in our catalog under these names: (2S)-2-Amino-2-(4-methoxyphenyl)ethan-1-ol hydrochloride, 95%, (2S)-2-AMINO-2-(4-METHOXYPHENYL)ETHAN-1-OL HCL, 98%, (2S)-2-Amino-2-(4-methoxyphenyl)ethan-1-ol hcl, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(2S)-2-amino-2-(4-methoxyphenyl)ethanol;hydrochloride (CAS 221697-17-2) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: (2S)-2-amino-2-(4-methoxyphenyl)ethanol;hydrochloride. InChIKey: MAXXCANBKVBAQQ-SBSPUUFOSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-methoxyphenyl)ethanol;hydrochloride |
| InChIKey | MAXXCANBKVBAQQ-SBSPUUFOSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)