(R)-2-Amino-2-(3-chlorophenyl)ethanol, 97%
cas: 926291-77-2 — see every product listed under this CAS number, including other names
(R)-2-Amino-2-(3-chlorophenyl)ethanol, 97% (CAS 926291-77-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A132233-100mg |
| cas | 926291-77-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 664.40 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| BLDpharm | 100mg | 142.20 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 269.93 Pln | |
| BLDpharm | 5g | 858.61 Pln | |
| Fluorochem | 250mg | 148.92 Pln | |
| Fluorochem | 1g | 242.64 Pln | |
| Fluorochem | 5g | 820.56 Pln | |
| Fluorochem | 10g | 1585.92 Pln | |
| Fluorochem | 25g | 3798.68 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-2-amino-2-(3-chlorophenyl)ethanol (CAS 926291-77-2) is a chemical compound with the molecular formula C8H10ClNO and a molecular weight of 171.62 g/mol. IUPAC name: (2R)-2-amino-2-(3-chlorophenyl)ethanol. InChIKey: HLXHAXFWWGYXQW-QMMMGPOBSA-N.
| Molecular formula | C8H10ClNO |
|---|---|
| Molecular weight | 171.62 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-chlorophenyl)ethanol |
| InChIKey | HLXHAXFWWGYXQW-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CO)N |
Computed by PubChem (NCBI)