Products 213990-63-7
CAS 213990-63-7 appears in our catalog under these names: (2S)-2-Amino-2-(2-chlorophenyl)ethan-1-ol, 95%, (S)–2–amino–2–(2–chlorophenyl)ethanol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2S)-2-amino-2-(2-chlorophenyl)ethanol (CAS 213990-63-7) is a chemical compound with the molecular formula C8H10ClNO and a molecular weight of 171.62 g/mol. IUPAC name: (2S)-2-amino-2-(2-chlorophenyl)ethanol. InChIKey: HALZSHRJUMADMG-MRVPVSSYSA-N.
| Molecular formula | C8H10ClNO |
|---|---|
| Molecular weight | 171.62 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-chlorophenyl)ethanol |
| InChIKey | HALZSHRJUMADMG-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](CO)N)Cl |
Computed by PubChem (NCBI)