(R)-2-Amino-2-(3-fluorophenyl)acetic acid, 98%
cas: 25698-44-6 — see every product listed under this CAS number, including other names
(R)-2-Amino-2-(3-fluorophenyl)acetic acid, 98% (CAS 25698-44-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD291125-100mg |
| cas | 25698-44-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 169.96 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 530.95 Pln | |
| BLDpharm | 5g | 2247.01 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 410.00 Pln | |
| Chemat | 5g | 1792.40 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 2148.22 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-amino-2-(3-fluorophenyl)acetic acid (CAS 25698-44-6) is a chemical compound with the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. IUPAC name: (2R)-2-amino-2-(3-fluorophenyl)acetic acid. InChIKey: LVYBCZIDQKJNFP-SSDOTTSWSA-N.
| Molecular formula | C8H8FNO2 |
|---|---|
| Molecular weight | 169.15 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-fluorophenyl)acetic acid |
| InChIKey | LVYBCZIDQKJNFP-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)