cas: 498-40-8 — see every product listed under this CAS number, including other names
(R)-2-Amino-3-sulfopropanoic acid, 95% (CAS 498-40-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517654-1G |
| cas | 498-40-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 25g | 388.42 Pln | |
| Fluorochem | 100g | 1393.28 Pln | |
| Fluorochem | 500g | 4475.53 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
L-cysteic acid is the L-enantiomer of cysteic acid. It has a role as an Escherichia coli metabolite and a human metabolite. It is a cysteic acid, an amino sulfonic acid, a non-proteinogenic L-alpha-amino acid, a L-cysteine derivative and a L-alanine derivative. It is a conjugate acid of a L-cysteate(1-).
Source: ChEBI
| Molecular formula | C3H7NO5S |
|---|---|
| Molecular weight | 169.16 g/mol |
| IUPAC name | (2R)-2-amino-3-sulfopropanoic acid |
| InChIKey | XVOYSCVBGLVSOL-REOHCLBHSA-N |
| SMILES | C([C@@H](C(=O)O)N)S(=O)(=O)O |
Computed by PubChem (NCBI)