cas: 498-40-8 — see every product listed under this CAS number, including other names
L-Cysteic acid, 98.0% (CAS 498-40-8) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 5 g, 100 g, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-124009-25 g |
| cas | 498-40-8 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 435.79 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 100 g | 1383.17 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
L-cysteic acid is the L-enantiomer of cysteic acid. It has a role as an Escherichia coli metabolite and a human metabolite. It is a cysteic acid, an amino sulfonic acid, a non-proteinogenic L-alpha-amino acid, a L-cysteine derivative and a L-alanine derivative. It is a conjugate acid of a L-cysteate(1-).
Source: ChEBI
| Molecular formula | C3H7NO5S |
|---|---|
| Molecular weight | 169.16 g/mol |
| IUPAC name | (2R)-2-amino-3-sulfopropanoic acid |
| InChIKey | XVOYSCVBGLVSOL-REOHCLBHSA-N |
| SMILES | C([C@@H](C(=O)O)N)S(=O)(=O)O |
Computed by PubChem (NCBI)