CAS 1867654-07-6 appears in our catalog under these names: (R)–2–Amino–N–benzyl–N,3,3–trimethylbutanamide, (R)-2-Amino-N-benzyl-N,3,3-trimethylbutanamide, 97%, 97%, (R)-2-Amino-N-benzyl-N,3,3-trimethylbutanamide, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2R)-2-amino-N-benzyl-N,3,3-trimethylbutanamide (CAS 1867654-07-6) is a chemical compound with the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. IUPAC name: (2R)-2-amino-N-benzyl-N,3,3-trimethylbutanamide. InChIKey: FZJOYZVWYQVWSP-LBPRGKRZSA-N.
| Molecular formula | C14H22N2O |
|---|---|
| Molecular weight | 234.34 g/mol |
| IUPAC name | (2R)-2-amino-N-benzyl-N,3,3-trimethylbutanamide |
| InChIKey | FZJOYZVWYQVWSP-LBPRGKRZSA-N |
| SMILES | CC(C)(C)[C@H](C(=O)N(C)CC1=CC=CC=C1)N |
Computed by PubChem (NCBI)