Products 947383-62-2
CAS 947383-62-2 appears in our catalog under these names: (2S)–2–Amino–N,3,3–trimethyl–N–(phenylmethyl)butanamide, (S)-2-Amino-N-benzyl-N,3,3-trimethylbutanamide, 98%, 98%, (S)-2-Amino-N-benzyl-N,3,3-trimethylbutanamide, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-N-benzyl-N,3,3-trimethylbutanamide (CAS 947383-62-2) is a chemical compound with the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. IUPAC name: (2S)-2-amino-N-benzyl-N,3,3-trimethylbutanamide. InChIKey: FZJOYZVWYQVWSP-GFCCVEGCSA-N.
| Molecular formula | C14H22N2O |
|---|---|
| Molecular weight | 234.34 g/mol |
| IUPAC name | (2S)-2-amino-N-benzyl-N,3,3-trimethylbutanamide |
| InChIKey | FZJOYZVWYQVWSP-GFCCVEGCSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)N(C)CC1=CC=CC=C1)N |
Computed by PubChem (NCBI)