cas: 112211-92-4 — see every product listed under this CAS number, including other names
(R)-2-Isopropylamino-2-phenylethanol, ≥98%, ≥98% (CAS 112211-92-4) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C06-200mg |
| cas | 112211-92-4 |
| size | 200mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 146.00 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 25g | 2790.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-phenyl-2-(propan-2-ylamino)ethanol (CAS 112211-92-4) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: (2R)-2-phenyl-2-(propan-2-ylamino)ethanol. InChIKey: XFSCVCVPECOHBL-NSHDSACASA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | (2R)-2-phenyl-2-(propan-2-ylamino)ethanol |
| InChIKey | XFSCVCVPECOHBL-NSHDSACASA-N |
| SMILES | CC(C)N[C@@H](CO)C1=CC=CC=C1 |
Computed by PubChem (NCBI)